cas: 76263-21-3 — see every product listed under this CAS number, including other names
3-(4-(Trifluoromethyl)phenoxy)azetidine, 97% (CAS 76263-21-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A383842-25g |
| cas | 76263-21-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10752.91 Pln | |
| AmBeed | 250mg | 948.85 Pln | |
| AmBeed | 10g | 5408.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[4-(trifluoromethyl)phenoxy]azetidine (CAS 76263-21-3) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenoxy]azetidine. InChIKey: RKANEZKQFZAZHZ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenoxy]azetidine |
| InChIKey | RKANEZKQFZAZHZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)