CAS 1208-64-6 appears in our catalog under these names: 3-(4-tert-Butylphenyl)propionic acid, 95%, 3-(4-tert-Butylbenzene)propionic Acid, >95% (HPLC), 3-(4-tert-Butylphenyl)propionic acid, 97% , 3-(4-(tert-Butyl)phenyl)propanoic acid, 96%, 96%, 3-(4-tert-Butyl-phenyl)-propionic acid, 98%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 2,5g, 250mg, 100g.
3-(4-tert-butylphenyl)propanoic acid (CAS 1208-64-6) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 3-(4-tert-butylphenyl)propanoic acid. InChIKey: BNJYANVQFVSYEK-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)propanoic acid |
| InChIKey | BNJYANVQFVSYEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)