CAS 92035-95-5 appears in our catalog under these names: 2,6-Diisopropylbenzoic Acid, 95%, 95%, 2,6-Diisopropylbenzoic acid, 95%, 2,6-Diisopropylbenzoic Acid 95%, Propofol Impurity 11, 2,6-Diisopropylbenzoic Acid. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, on request, 50mg.
2,6-di(propan-2-yl)benzoic acid (CAS 92035-95-5) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2,6-di(propan-2-yl)benzoic acid. InChIKey: AGBGSHYCQQNNEH-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2,6-di(propan-2-yl)benzoic acid |
| InChIKey | AGBGSHYCQQNNEH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)C(=O)O |
Computed by PubChem (NCBI)