cas: 1384264-75-8 — see every product listed under this CAS number, including other names
3-(4-Bromophenyl)azetidin-3-amine Dihydrochloride, ≥95%, ≥95% (CAS 1384264-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11205J-100mg |
| cas | 1384264-75-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1341.20 Pln | |
| Chemat | 250mg | 2109.20 Pln | |
| Chemat | 1g | 5181.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-(4-bromophenyl)azetidin-3-amine;dihydrochloride (CAS 1384264-75-8) is a chemical compound with the molecular formula C9H13BrCl2N2 and a molecular weight of 300.02 g/mol. IUPAC name: 3-(4-bromophenyl)azetidin-3-amine;dihydrochloride. InChIKey: KRKOCZLAJJLVEZ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrCl2N2 |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 3-(4-bromophenyl)azetidin-3-amine;dihydrochloride |
| InChIKey | KRKOCZLAJJLVEZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=C(C=C2)Br)N.Cl.Cl |
Computed by PubChem (NCBI)