CAS 1384264-75-8 appears in our catalog under these names: 3-(4-Bromophenyl)azetidin-3-amine dihydrochloride, 95%, 3-(4-Bromophenyl)azetidin-3-amine Dihydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-(4-bromophenyl)azetidin-3-amine;dihydrochloride (CAS 1384264-75-8) is a chemical compound with the molecular formula C9H13BrCl2N2 and a molecular weight of 300.02 g/mol. IUPAC name: 3-(4-bromophenyl)azetidin-3-amine;dihydrochloride. InChIKey: KRKOCZLAJJLVEZ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrCl2N2 |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 3-(4-bromophenyl)azetidin-3-amine;dihydrochloride |
| InChIKey | KRKOCZLAJJLVEZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=C(C=C2)Br)N.Cl.Cl |
Computed by PubChem (NCBI)