3-(4-Methoxyphenyl)oxetane-3-sulfonyl fluoride, 95%
cas: 2761830-88-8 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)oxetane-3-sulfonyl fluoride, 95% (CAS 2761830-88-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1682795-25mg |
| cas | 2761830-88-8 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 665.19 Pln | |
| Ambeed | 50mg | 1087.94 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 8436.00 Pln | |
| BLDpharm | 25mg | 714.22 Pln | |
| BLDpharm | 50mg | 1164.06 Pln | |
| BLDpharm | 100mg | 1930.46 Pln | |
| BLDpharm | 250mg | 3413.27 Pln | |
| BLDpharm | 1g | 9089.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride (CAS 2761830-88-8) is a chemical compound with the molecular formula C10H11FO4S and a molecular weight of 246.26 g/mol. IUPAC name: 3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride. InChIKey: ZXSRYNIWIGQECK-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4S |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride |
| InChIKey | ZXSRYNIWIGQECK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(COC2)S(=O)(=O)F |
Computed by PubChem (NCBI)