CAS 2761830-88-8 appears in our catalog under these names: 3-(4-Methoxyphenyl)oxetane-3-sulfonyl fluoride, 95%, 3-(4-Methoxyphenyl)oxetane-3-sulfonyl fluoride 95%. Offered by: Ambeed. Available pack sizes: 250mg, 25mg, 50mg, 1g, 5g.
3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride (CAS 2761830-88-8) is a chemical compound with the molecular formula C10H11FO4S and a molecular weight of 246.26 g/mol. IUPAC name: 3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride. InChIKey: ZXSRYNIWIGQECK-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4S |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)oxetane-3-sulfonyl fluoride |
| InChIKey | ZXSRYNIWIGQECK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(COC2)S(=O)(=O)F |
Computed by PubChem (NCBI)