cas: 1239986-50-5 — see every product listed under this CAS number, including other names
3-(5,6-DIHYDRO-4H-PYRROLO[3,2,1-IJ]QUINOLIN-1-YL)-4-(1H-INDOL-3-YL)-PYRROLIDINE-2,5-DIONE, 98%, 98% (CAS 1239986-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C8P-100mg |
| cas | 1239986-50-5 |
| size | 100mg |
| availability | 5.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2915.60 Pln | |
| Chemat | 250mg | 5781.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (CAS 1239986-50-5) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione. InChIKey: UCEQXRCJXIVODC-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| InChIKey | UCEQXRCJXIVODC-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C2)C(=CN3C1)C4C(C(=O)NC4=O)C5=CNC6=CC=CC=C65 |
Computed by PubChem (NCBI)