cas: 29079-97-8 — see every product listed under this CAS number, including other names
3-(5-Bromothiophen-2-yl)acrylic acid 95% (CAS 29079-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A265406-100mg |
| cas | 29079-97-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 598.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A265406 |
(E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid (CAS 29079-97-8) is a chemical compound with the molecular formula C7H5BrO2S and a molecular weight of 233.08 g/mol. IUPAC name: (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid. InChIKey: UNAWXLDSXIIUFC-DUXPYHPUSA-N.
| Molecular formula | C7H5BrO2S |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid |
| InChIKey | UNAWXLDSXIIUFC-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)