CAS 29079-97-8 appears in our catalog under these names: (2E)-3-(5-Bromo(2-thienyl))prop-2-enoic acid, 95%, 3-(5-Bromothiophen-2-yl)acrylic acid, 95%, 95%, 3-(5-Bromothiophen-2-yl)acrylic acid, 98%, 3-(5-Bromothiophen-2-yl)acrylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid (CAS 29079-97-8) is a chemical compound with the molecular formula C7H5BrO2S and a molecular weight of 233.08 g/mol. IUPAC name: (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid. InChIKey: UNAWXLDSXIIUFC-DUXPYHPUSA-N.
| Molecular formula | C7H5BrO2S |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid |
| InChIKey | UNAWXLDSXIIUFC-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)