3-(6-(Azidomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%
cas: 2866306-90-1 — see every product listed under this CAS number, including other names
3-(6-(Azidomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95% (CAS 2866306-90-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2884876-25mg |
| cas | 2866306-90-1 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 820.94 Pln | |
| Ambeed | 100mg | 1961.25 Pln | |
| Ambeed | 250mg | 3846.94 Pln | |
| BLDpharm | 25mg | 880.83 Pln | |
| BLDpharm | 50mg | 1369.54 Pln | |
| BLDpharm | 100mg | 2108.17 Pln | |
| BLDpharm | 250mg | 4146.34 Pln | |
| Chemat | 25mg | 626.00 Pln | |
| Chemat | 50mg | 966.80 Pln | |
| Chemat | 100mg | 1475.60 Pln | |
| Chemat | 250mg | 2886.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[5-(azidomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2866306-90-1) is a chemical compound with the molecular formula C14H13N5O3 and a molecular weight of 299.28 g/mol. IUPAC name: 3-[5-(azidomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: JQGMBUQELUDPMO-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O3 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 3-[5-(azidomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | JQGMBUQELUDPMO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3)CN=[N+]=[N-] |
Computed by PubChem (NCBI)