CAS 1370592-91-8 is the registry number for Ethyl 3-[1-(4-methylphenyl)-1h-1,2,3-triazol-4-yl]-1,2,4-oxadiazole-5-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3-[1-(4-methylphenyl)triazol-4-yl]-1,2,4-oxadiazole-5-carboxylate (CAS 1370592-91-8) is a chemical compound with the molecular formula C14H13N5O3 and a molecular weight of 299.28 g/mol. IUPAC name: ethyl 3-[1-(4-methylphenyl)triazol-4-yl]-1,2,4-oxadiazole-5-carboxylate. InChIKey: ZKBAGZOZTVKRPR-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O3 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | ethyl 3-[1-(4-methylphenyl)triazol-4-yl]-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | ZKBAGZOZTVKRPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CN(N=N2)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)