cas: 162167-97-7 — see every product listed under this CAS number, including other names
3-(Aminomethyl)-1-N-Boc-piperidine, 97% (CAS 162167-97-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011388-1G |
| cas | 162167-97-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 497.76 Pln | |
| Fluorochem | 100g | 1658.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-(aminomethyl)piperidine-1-carboxylate (CAS 162167-97-7) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)piperidine-1-carboxylate. InChIKey: WPWXYQIMXTUMJB-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | WPWXYQIMXTUMJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CN |
Computed by PubChem (NCBI)