cas: 21970-65-0 — see every product listed under this CAS number, including other names
3-(Benzyl(methyl)amino)-1-phenylpropan-1-one 97% (CAS 21970-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145202-100mg |
| cas | 21970-65-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 1494.00 Pln | |
| Ambeed | 25g | 5054.00 Pln | |
| Ambeed | 100g | 14838.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1145202 |
3-[benzyl(methyl)amino]-1-phenylpropan-1-one (CAS 21970-65-0) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: 3-[benzyl(methyl)amino]-1-phenylpropan-1-one. InChIKey: LNCWFHRJTAQGBG-UHFFFAOYSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 3-[benzyl(methyl)amino]-1-phenylpropan-1-one |
| InChIKey | LNCWFHRJTAQGBG-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)C1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)