cas: 21970-65-0 — see every product listed under this CAS number, including other names
3-(Benzyl(methyl)amino)-1-phenylpropan-1-one, 97%, 97% (CAS 21970-65-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E4SX-10g |
| cas | 21970-65-0 |
| size | 10g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1341.20 Pln | |
| Chemat | 25g | 4538.00 Pln | |
| Chemat | 100g | 14090.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[benzyl(methyl)amino]-1-phenylpropan-1-one (CAS 21970-65-0) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: 3-[benzyl(methyl)amino]-1-phenylpropan-1-one. InChIKey: LNCWFHRJTAQGBG-UHFFFAOYSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 3-[benzyl(methyl)amino]-1-phenylpropan-1-one |
| InChIKey | LNCWFHRJTAQGBG-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)C1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)