cas: 1251033-82-5 — see every product listed under this CAS number, including other names
3-(Boc-aminomethyl)pyrazole, 97% (CAS 1251033-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546301-250MG |
| cas | 1251033-82-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 945.52 Pln | |
| Fluorochem | 1g | 2502.26 Pln | |
| Fluorochem | 5g | 8573.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(1H-pyrazol-5-ylmethyl)carbamate (CAS 1251033-82-5) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl N-(1H-pyrazol-5-ylmethyl)carbamate. InChIKey: JXNFVHMWICVPPJ-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl N-(1H-pyrazol-5-ylmethyl)carbamate |
| InChIKey | JXNFVHMWICVPPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=NN1 |
Computed by PubChem (NCBI)