Products 53681-50-8

CAS 53681-50-8 is the registry number for 6-Amino-1-butyl-3-methyl-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

6-amino-1-butyl-3-methylpyrimidine-2,4-dione (CAS 53681-50-8) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: 6-amino-1-butyl-3-methylpyrimidine-2,4-dione. InChIKey: MKJULKCPESFFJU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15N3O2
Molecular weight197.23 g/mol
IUPAC name6-amino-1-butyl-3-methylpyrimidine-2,4-dione
InChIKeyMKJULKCPESFFJU-UHFFFAOYSA-N
SMILESCCCCN1C(=CC(=O)N(C1=O)C)N

Computed by PubChem (NCBI)