cas: 1060814-58-5 — see every product listed under this CAS number, including other names
3-(CHLOROMETHYL)-2-(TRIFLUOROMETHYL)PYRIDINE, 97% (CAS 1060814-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F806398-100MG |
| cas | 1060814-58-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 976.76 Pln | |
| Fluorochem | 250mg | 1669.22 Pln | |
| Fluorochem | 1g | 4163.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(chloromethyl)-2-(trifluoromethyl)pyridine (CAS 1060814-58-5) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 3-(chloromethyl)-2-(trifluoromethyl)pyridine. InChIKey: DWOQJLJLLCVGTF-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 3-(chloromethyl)-2-(trifluoromethyl)pyridine |
| InChIKey | DWOQJLJLLCVGTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)