cas: 273722-75-1 — see every product listed under this CAS number, including other names
3-(Cyclopentyloxy)benzaldehyde, 98%, 98% (CAS 273722-75-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDKR-100mg |
| cas | 273722-75-1 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 794.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-cyclopentyloxybenzaldehyde (CAS 273722-75-1) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 3-cyclopentyloxybenzaldehyde. InChIKey: WWUQYSHWTLWESE-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 3-cyclopentyloxybenzaldehyde |
| InChIKey | WWUQYSHWTLWESE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)