3-(Difluoromethyl)-4-fluorobenzoic acid, 95%
cas: 1781570-25-9 — see every product listed under this CAS number, including other names
3-(Difluoromethyl)-4-fluorobenzoic acid, 95% (CAS 1781570-25-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1105757-250mg |
| cas | 1781570-25-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1321.56 Pln | |
| Ambeed | 1g | 3390.81 Pln | |
| BLDpharm | 100mg | 847.50 Pln | |
| BLDpharm | 250mg | 1413.97 Pln | |
| BLDpharm | 1g | 3652.07 Pln | |
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2229.20 Pln | |
| Fluorochem | 100mg | 804.94 Pln | |
| Fluorochem | 250mg | 1362.04 Pln | |
| Fluorochem | 1g | 3460.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(difluoromethyl)-4-fluorobenzoic acid (CAS 1781570-25-9) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 3-(difluoromethyl)-4-fluorobenzoic acid. InChIKey: XNQVOHDSKCXHCT-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 3-(difluoromethyl)-4-fluorobenzoic acid |
| InChIKey | XNQVOHDSKCXHCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)F)F |
Computed by PubChem (NCBI)