CAS 1214326-36-9 appears in our catalog under these names: 2-(Difluoromethoxy)-5-fluorobenzaldehyde, 95%, 2-(Difluoromethoxy)-5-fluorobenzaldehyde. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(difluoromethoxy)-5-fluorobenzaldehyde (CAS 1214326-36-9) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2-(difluoromethoxy)-5-fluorobenzaldehyde. InChIKey: GUZRILZWIBSBAR-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-5-fluorobenzaldehyde |
| InChIKey | GUZRILZWIBSBAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C=O)OC(F)F |
Computed by PubChem (NCBI)