cas: 72679-97-1 — see every product listed under this CAS number, including other names
3-(Hydroxymethyl)benzo[d]thiazol-2(3H)-one, 98%, 98% (CAS 72679-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116Q6F-100mg |
| cas | 72679-97-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1158.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(hydroxymethyl)-1,3-benzothiazol-2-one (CAS 72679-97-1) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 3-(hydroxymethyl)-1,3-benzothiazol-2-one. InChIKey: QGEJJONTBKAEKC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-(hydroxymethyl)-1,3-benzothiazol-2-one |
| InChIKey | QGEJJONTBKAEKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)S2)CO |
Computed by PubChem (NCBI)