Products 858819-96-2
CAS 858819-96-2 appears in our catalog under these names: 3-Aminobenzothiophene-1,1-dione, 97%, 3-Aminobenzo(b)thiophene 1,1-dioxide, 97%, 3-Aminobenzothiophene-1,1-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
1,1-dioxo-1-benzothiophen-3-amine (CAS 858819-96-2) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 1,1-dioxo-1-benzothiophen-3-amine. InChIKey: TTXJXSIERYHUJE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 1,1-dioxo-1-benzothiophen-3-amine |
| InChIKey | TTXJXSIERYHUJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2(=O)=O)N |
Computed by PubChem (NCBI)