cas: 22821-75-6 — see every product listed under this CAS number, including other names
3-(Methylsulfonyl)benzonitrile, 95% (CAS 22821-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023668-1G |
| cas | 22821-75-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-methylsulfonylbenzonitrile (CAS 22821-75-6) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 3-methylsulfonylbenzonitrile. InChIKey: VWPJXEYDYJQMBC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-methylsulfonylbenzonitrile |
| InChIKey | VWPJXEYDYJQMBC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)