cas: 723281-55-8 — see every product listed under this CAS number, including other names
3-(Morpholine-4-carbonyl)phenylboronic acid 98% (CAS 723281-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A879012-100mg |
| cas | 723281-55-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Ambeed | 25g | 2834.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A879012 |
[3-(morpholine-4-carbonyl)phenyl]boronic acid (CAS 723281-55-8) is a chemical compound with the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. IUPAC name: [3-(morpholine-4-carbonyl)phenyl]boronic acid. InChIKey: DRZFURCXDFRZNR-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO4 |
|---|---|
| Molecular weight | 235.05 g/mol |
| IUPAC name | [3-(morpholine-4-carbonyl)phenyl]boronic acid |
| InChIKey | DRZFURCXDFRZNR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)