Products 502622-85-7
CAS 502622-85-7 appears in our catalog under these names: 4-Nitrophenylboronic acid neopentyl glycol ester, 95%, 5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane, 95-<97%, 5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane, ≥97-<99%, 5，5–dimethyl–2–(4–nitrophenyl)–1，3，2–dioxaborinane, 5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 50g, 100g, 200g, 300g.
5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane (CAS 502622-85-7) is a chemical compound with the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. IUPAC name: 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: RRGGUJKPJNSZFX-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO4 |
|---|---|
| Molecular weight | 235.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | RRGGUJKPJNSZFX-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)