cas: 397843-69-5 — see every product listed under this CAS number, including other names
3-(N-Isopropylaminocarbonyl)benzeneboronic acid, 98%, 98% (CAS 397843-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149RF-250mg |
| cas | 397843-69-5 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 5g | 1931.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(propan-2-ylcarbamoyl)phenyl]boronic acid (CAS 397843-69-5) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [3-(propan-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: QDCRYXCSQKAWNM-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [3-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | QDCRYXCSQKAWNM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC(C)C)(O)O |
Computed by PubChem (NCBI)