Products 833-96-5

CAS 833-96-5 is the registry number for 3-(Pentafluorosulfanyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(pentafluoro-lambda6-sulfanyl)benzoic acid (CAS 833-96-5) is a chemical compound with the molecular formula C7H5F5O2S and a molecular weight of 248.17 g/mol. IUPAC name: 3-(pentafluoro-lambda6-sulfanyl)benzoic acid. InChIKey: AKFDIYXSRGLRAB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F5O2S
Molecular weight248.17 g/mol
IUPAC name3-(pentafluoro-lambda6-sulfanyl)benzoic acid
InChIKeyAKFDIYXSRGLRAB-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(F)(F)(F)(F)F)C(=O)O

Computed by PubChem (NCBI)