CAS 1159512-31-8 appears in our catalog under these names: 2-Hydroxy-5-(pentafluorothio)benzaldehyde, 95%, 2-hydroxy-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
2-hydroxy-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde (CAS 1159512-31-8) is a chemical compound with the molecular formula C7H5F5O2S and a molecular weight of 248.17 g/mol. IUPAC name: 2-hydroxy-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde. InChIKey: GNLGOMVJAGNVSE-UHFFFAOYSA-N.
| Molecular formula | C7H5F5O2S |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | 2-hydroxy-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde |
| InChIKey | GNLGOMVJAGNVSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(F)(F)(F)(F)F)C=O)O |
Computed by PubChem (NCBI)