cas: 93189-16-3 — see every product listed under this CAS number, including other names
3-(Phenoxymethyl)aniline (CAS 93189-16-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVV9-5mg |
| cas | 93189-16-3 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
3-(phenoxymethyl)aniline (CAS 93189-16-3) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 3-(phenoxymethyl)aniline. InChIKey: FSQPEMRQTZGIRF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-(phenoxymethyl)aniline |
| InChIKey | FSQPEMRQTZGIRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)