cas: 10154-75-3 — see every product listed under this CAS number, including other names
3-(Phenylsulfonyl)propanenitrile, 95%, 95% (CAS 10154-75-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115R8-100mg |
| cas | 10154-75-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 458.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(benzenesulfonyl)propanenitrile (CAS 10154-75-3) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 3-(benzenesulfonyl)propanenitrile. InChIKey: OVZPZPVSUAKTCM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 3-(benzenesulfonyl)propanenitrile |
| InChIKey | OVZPZPVSUAKTCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCC#N |
Computed by PubChem (NCBI)