CAS 106748-27-0 appears in our catalog under these names: Methyl 3-carbamothioylbenzoate, 96%, Methyl 3-carbamothioylbenzoate, 97%, Methyl 3-carbamothioylbenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
Methyl 3-carbamothioylbenzoate (CAS 106748-27-0) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: methyl 3-carbamothioylbenzoate. InChIKey: MBBRSLODSVCTGY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | methyl 3-carbamothioylbenzoate |
| InChIKey | MBBRSLODSVCTGY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=S)N |
Computed by PubChem (NCBI)