cas: 158861-24-6 — see every product listed under this CAS number, including other names
3-(Piperidin-1-ylmethyl)benzoic acid, 98% (CAS 158861-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065793-100MG |
| cas | 158861-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 612.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(piperidin-1-ylmethyl)benzoic acid (CAS 158861-24-6) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 3-(piperidin-1-ylmethyl)benzoic acid. InChIKey: UIXWGRXBYZGOQK-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 3-(piperidin-1-ylmethyl)benzoic acid |
| InChIKey | UIXWGRXBYZGOQK-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)