CAS 925253-03-8 is the registry number for Trans-tert-butyl 3-phenylaziridine-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2S,3R)-3-phenylaziridine-2-carboxylate (CAS 925253-03-8) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: tert-butyl (2S,3R)-3-phenylaziridine-2-carboxylate. InChIKey: SJENAWGNJMLOIZ-MNOVXSKESA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-phenylaziridine-2-carboxylate |
| InChIKey | SJENAWGNJMLOIZ-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)