cas: 2740-83-2 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)benzylamine (CAS 2740-83-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007603-1G |
| cas | 2740-83-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 716.43 Pln |
| delivery time | 1-2 weeks |
|---|
[3-(trifluoromethyl)phenyl]methanamine (CAS 2740-83-2) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]methanamine. InChIKey: YKNZTUQUXUXTLE-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | YKNZTUQUXUXTLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN |
Computed by PubChem (NCBI)