cas: 2740-83-2 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)benzylamine 97% (CAS 2740-83-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233117-5g |
| cas | 2740-83-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 2478.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A233117 |
[3-(trifluoromethyl)phenyl]methanamine (CAS 2740-83-2) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]methanamine. InChIKey: YKNZTUQUXUXTLE-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | YKNZTUQUXUXTLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN |
Computed by PubChem (NCBI)