cas: 262608-95-7 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenyltrimethylammonium Bromide (CAS 262608-95-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C3WS-25g |
| cas | 262608-95-7 |
| size | 25g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1523.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 424.40 Pln |
| delivery time | 3 weeks |
|---|
Trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide (CAS 262608-95-7) is a chemical compound with the molecular formula C10H13BrF3N and a molecular weight of 284.12 g/mol. IUPAC name: trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide. InChIKey: KPFRXMSETZXGKJ-UHFFFAOYSA-M.
| Molecular formula | C10H13BrF3N |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide |
| InChIKey | KPFRXMSETZXGKJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC=CC(=C1)C(F)(F)F.[Br-] |
Computed by PubChem (NCBI)