CAS 262608-95-7 appears in our catalog under these names: 3-(Trifluoromethyl)phenyltrimethylammonium bromide, 98%, 3–(Trifluoromethyl)phenyltrimethylammonium Bromide, 3-(Trifluoromethyl)phenyltrimethylammonium Bromide, >98.0%(HPLC)(T), 3-(Trifluoromethyl)phenyltrimethylammonium Bromide, 3-(Trifluoromethyl)phenyltrimethylammoniumbromide. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, Get quote.
Trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide (CAS 262608-95-7) is a chemical compound with the molecular formula C10H13BrF3N and a molecular weight of 284.12 g/mol. IUPAC name: trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide. InChIKey: KPFRXMSETZXGKJ-UHFFFAOYSA-M.
| Molecular formula | C10H13BrF3N |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | trimethyl-[3-(trifluoromethyl)phenyl]azanium bromide |
| InChIKey | KPFRXMSETZXGKJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC=CC(=C1)C(F)(F)F.[Br-] |
Computed by PubChem (NCBI)