cas: 27389-57-7 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenyltrimethylammonium Iodide (CAS 27389-57-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114IB5-1g |
| cas | 27389-57-7 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 25g | 560.24 Pln |
| delivery time | 3 weeks |
|---|
Trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide (CAS 27389-57-7) is a chemical compound with the molecular formula C10H13F3IN and a molecular weight of 331.12 g/mol. IUPAC name: trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide. InChIKey: VKZIUXSJJSEBAK-UHFFFAOYSA-M.
| Molecular formula | C10H13F3IN |
|---|---|
| Molecular weight | 331.12 g/mol |
| IUPAC name | trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide |
| InChIKey | VKZIUXSJJSEBAK-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC=CC(=C1)C(F)(F)F.[I-] |
Computed by PubChem (NCBI)