CAS 27389-57-7 appears in our catalog under these names: 3-(Trifluoromethyl)phenyltrimethylammonium iodide, 98%, N,N,N-Trimethyl-3-(trifluoromethyl)benzenaminium iodide, 98%, 3–(Trifluoromethyl)phenyltrimethylammonium Iodide, 3-(Trifluoromethyl)phenyltrimethylammonium Iodide, >98.0%(T), 3-(Trifluoromethyl)phenyltrimethylammonium Iodide. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, Get quote.
Trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide (CAS 27389-57-7) is a chemical compound with the molecular formula C10H13F3IN and a molecular weight of 331.12 g/mol. IUPAC name: trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide. InChIKey: VKZIUXSJJSEBAK-UHFFFAOYSA-M.
| Molecular formula | C10H13F3IN |
|---|---|
| Molecular weight | 331.12 g/mol |
| IUPAC name | trimethyl-[3-(trifluoromethyl)phenyl]azanium iodide |
| InChIKey | VKZIUXSJJSEBAK-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC=CC(=C1)C(F)(F)F.[I-] |
Computed by PubChem (NCBI)