cas: 131747-62-1 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)pyridine-2-carboxaldehyde (CAS 131747-62-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093298-250MG |
| cas | 131747-62-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 5g | 1887.89 Pln |
| delivery time | 3-4 weeks |
|---|
3-(trifluoromethyl)pyridine-2-carbaldehyde (CAS 131747-62-1) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: 3-(trifluoromethyl)pyridine-2-carbaldehyde. InChIKey: FIIIEUQXYKDPRD-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | 3-(trifluoromethyl)pyridine-2-carbaldehyde |
| InChIKey | FIIIEUQXYKDPRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)