cas: 906-65-0 — see every product listed under this CAS number, including other names
3-(Triphenylphosphoranylidene)Dihydrofuran-2,5-Dione (CAS 906-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114F7B-250mg |
| cas | 906-65-0 |
| size | 250mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 25g | 2392.40 Pln | |
| Chemat | 10g | 1000.40 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 25g | 3939.26 Pln |
| delivery time | 3 weeks |
|---|
3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione (CAS 906-65-0) is a chemical compound with the molecular formula C22H17O3P and a molecular weight of 360.3 g/mol. IUPAC name: 3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione. InChIKey: CXYNGWAHZKOMJQ-UHFFFAOYSA-N.
| Molecular formula | C22H17O3P |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione |
| InChIKey | CXYNGWAHZKOMJQ-UHFFFAOYSA-N |
| SMILES | C1C(=P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)OC1=O |
Computed by PubChem (NCBI)