cas: 183158-30-7 — see every product listed under this CAS number, including other names
3-(t-Butylaminocarbonyl)phenylboronic acid, 98%, 98% (CAS 183158-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135FF-1g |
| cas | 183158-30-7 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 698.00 Pln | |
| Chemat | 10g | 1211.60 Pln | |
| Chemat | 25g | 2046.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(tert-butylcarbamoyl)phenyl]boronic acid (CAS 183158-30-7) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [3-(tert-butylcarbamoyl)phenyl]boronic acid. InChIKey: MAFLCTFKZXDGGQ-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [3-(tert-butylcarbamoyl)phenyl]boronic acid |
| InChIKey | MAFLCTFKZXDGGQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)