CAS 33704-19-7 appears in our catalog under these names: 3-(tert-Butoxycarbonyl)benzoic acid, 3-(Tert-Butoxycarbonyl)Benzoic Acid, 98%, 98%, 3-(tert-Butoxycarbonyl)benzoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g.
3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 33704-19-7) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: OFILKMBFUQQLSU-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
| InChIKey | OFILKMBFUQQLSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)