cas: 876299-97-7 — see every product listed under this CAS number, including other names
3-(tert-Butyl)-1-(3-pyridyl)pyrazole-5-amine, >97%, >97% (CAS 876299-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IA0-250mg |
| cas | 876299-97-7 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1350.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-tert-butyl-1-pyridin-3-ylpyrazol-5-amine (CAS 876299-97-7) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 3-tert-butyl-1-pyridin-3-ylpyrazol-5-amine. InChIKey: PKZOPZWDEDXAED-UHFFFAOYSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 3-tert-butyl-1-pyridin-3-ylpyrazol-5-amine |
| InChIKey | PKZOPZWDEDXAED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CN=CC=C2 |
Computed by PubChem (NCBI)