3-(tert-Butyl)-4-hydroxybenzonitrile, 97%
cas: 4910-04-7 — see every product listed under this CAS number, including other names
3-(tert-Butyl)-4-hydroxybenzonitrile, 97% (CAS 4910-04-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A295533-250mg |
| cas | 4910-04-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 1060.12 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 653.13 Pln | |
| BLDpharm | 5g | 1819.38 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 784.40 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1091.30 Pln | |
| Fluorochem | 10g | 1762.94 Pln | |
| Fluorochem | 25g | 4288.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-tert-butyl-4-hydroxybenzonitrile (CAS 4910-04-7) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-tert-butyl-4-hydroxybenzonitrile. InChIKey: WOQNZPYFQSOAJS-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-tert-butyl-4-hydroxybenzonitrile |
| InChIKey | WOQNZPYFQSOAJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C#N)O |
Computed by PubChem (NCBI)