cas: 144525-40-6 — see every product listed under this CAS number, including other names
3-[(1E)-2-(2,4-Dihydroxyphenyl)ethenyl]-5-hydroxyphenyl β-D-glucopyranoside, ≥95%, ≥95% (CAS 144525-40-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 20mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ALR1-10mg |
| cas | 144525-40-6 |
| size | 10mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 1840.40 Pln | |
| Chemat | 20mg | 3021.20 Pln | |
| Chemat | 50mg | 5973.20 Pln | |
| Chemat | 100mg | 9664.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S,3R,4S,5S,6R)-2-[3-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-5-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 144525-40-6) is a chemical compound with the molecular formula C20H22O9 and a molecular weight of 406.4 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-[3-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-5-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: GGQVPULXXVQLRT-CUYWLFDKSA-N.
| Molecular formula | C20H22O9 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-[3-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-5-hydroxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | GGQVPULXXVQLRT-CUYWLFDKSA-N |
| SMILES | C1=CC(=C(C=C1O)O)/C=C/C2=CC(=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O |
Computed by PubChem (NCBI)