3-[2-(2-Azidoethoxy)ethoxy]propanoic acid, 97%, 97%
cas: 1312309-63-9 — see every product listed under this CAS number, including other names
3-[2-(2-Azidoethoxy)ethoxy]propanoic acid, 97%, 97% (CAS 1312309-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AOM-100mg |
| cas | 1312309-63-9 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1197.20 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 100g | 3851.60 Pln | |
| Chemat | 250g | 6698.00 Pln | |
| Chemat | 500g | 11198.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-(2-azidoethoxy)ethoxy]propanoic acid (CAS 1312309-63-9) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: 3-[2-(2-azidoethoxy)ethoxy]propanoic acid. InChIKey: IEHDSRSXQAOLJT-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O4 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 3-[2-(2-azidoethoxy)ethoxy]propanoic acid |
| InChIKey | IEHDSRSXQAOLJT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Azido-PEG2-acid, 3-[2-(2-azidoethoxy)ethoxy]propanoic acid, Azido-PEG2-C2-acid, 3-(2-(2-azidoethoxy)ethoxy)propanoic acid, Azido-PEG2-propionic acid, 9-Azido-4,7-dioxanonanoic acid, Azide-PEG2-carboxylic acid, orb1989518, Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, {2-[2-(2-carboxyethoxy)ethoxy]ethyl}(diazyn-1-ium-1-yl)azanide