CAS 1312309-63-9 appears in our catalog under these names: Azido-PEG2-acid, 96%, Azido-PEG2-C2-acid, Azido–PEG2–C2–acid, 3-[2-(2-Azidoethoxy)ethoxy]propanoic acid, 97%, 97%, Azido-PEG2-C2-acid, 99.88%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5g.
3-[2-(2-azidoethoxy)ethoxy]propanoic acid (CAS 1312309-63-9) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: 3-[2-(2-azidoethoxy)ethoxy]propanoic acid. InChIKey: IEHDSRSXQAOLJT-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O4 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 3-[2-(2-azidoethoxy)ethoxy]propanoic acid |
| InChIKey | IEHDSRSXQAOLJT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)