cas: 706820-95-3 — see every product listed under this CAS number, including other names
3-[N-(tert-Butyl)sulfamoyl]phenylboronic Acid Pinacol Ester 98+% (CAS 706820-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A684465-100mg |
| cas | 706820-95-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3185.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A684465 |
N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 706820-95-3) is a chemical compound with the molecular formula C16H26BNO4S and a molecular weight of 339.3 g/mol. IUPAC name: N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: VSJNPEGKWGUNOP-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO4S |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | VSJNPEGKWGUNOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)NC(C)(C)C |
Computed by PubChem (NCBI)